C28H26N4O5S — CID 4203404
N-[4-[[1,4-dioxo-3-(4-phenylpiperazin-1-yl)naphthalen-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 4203404) has the molecular formula C28H26N4O5S and a molecular weight of 530.61 g/mol. Its IUPAC name is N-[4-[[1,4-dioxo-3-(4-phenylpiperazin-1-yl)naphthalen-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1,4-dioxo-3-(4-phenylpiperazin-1-yl)naphthalen-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4203404 |
| Molecular Formula | C28H26N4O5S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | N-[4-[[1,4-dioxo-3-(4-phenylpiperazin-1-yl)naphthalen-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2=C(N3CCN(c4ccccc4)CC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H26N4O5S/c1-19(33)29-20-11-13-22(14-12-20)38(36,37)30-25-26(28(35)24-10-6-5-9-23(24)27(25)34)32-17-15-31(16-18-32)21-7-3-2-4-8-21/h2-14,30H,15-18H2,1H3,(H,29,33) |
| InChIKey | GIRILNLRUOHBJB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|