C24H20BrN3O2S — CID 14983539
N-[(E)-(4-bromophenyl)methylideneamino]-2-(2-ethoxyacridin-9-yl)sulfanylacetamide (PubChem CID 14983539) has the molecular formula C24H20BrN3O2S and a molecular weight of 494.41 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-2-(2-ethoxyacridin-9-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-2-(2-ethoxyacridin-9-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 14983539 |
| Molecular Formula | C24H20BrN3O2S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-2-(2-ethoxyacridin-9-yl)sulfanylacetamide |
| SMILES | CCOc1ccc2nc3ccccc3c(SCC(=O)N/N=C/c3ccc(Br)cc3)c2c1 |
| InChI | InChI=1S/C24H20BrN3O2S/c1-2-30-18-11-12-22-20(13-18)24(19-5-3-4-6-21(19)27-22)31-15-23(29)28-26-14-16-7-9-17(25)10-8-16/h3-14H,2,15H2,1H3,(H,28,29)/b26-14+ |
| InChIKey | IEJOXLFPBDYRPH-VULFUBBASA-N |
| XLogP | 5.79 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|