C12H13N3O3S — CID 1499221
ethyl 5-imino-2-(2-methoxyphenyl)thiadiazole-4-carboxylate (PubChem CID 1499221) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 5-imino-2-(2-methoxyphenyl)thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-imino-2-(2-methoxyphenyl)thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 1499221 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | ethyl 5-imino-2-(2-methoxyphenyl)thiadiazole-4-carboxylate |
| SMILES | [H]/N=c1\sn(-c2ccccc2OC)nc1C(=O)OCC |
| InChI | InChI=1S/C12H13N3O3S/c1-3-18-12(16)10-11(13)19-15(14-10)8-6-4-5-7-9(8)17-2/h4-7,13H,3H2,1-2H3/b13-11- |
| InChIKey | SHJWHEWGCOJCQS-QBFSEMIESA-N |
| XLogP | 1.60 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |