C17H21N3O3 — CID 22309705
ethyl 5-amino-3-cyclobutyl-1-(2-methoxyphenyl)pyrazole-4-carboxylate (PubChem CID 22309705) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 5-amino-3-cyclobutyl-1-(2-methoxyphenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-3-cyclobutyl-1-(2-methoxyphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22309705 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl 5-amino-3-cyclobutyl-1-(2-methoxyphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C2CCC2)nn(-c2ccccc2OC)c1N |
| InChI | InChI=1S/C17H21N3O3/c1-3-23-17(21)14-15(11-7-6-8-11)19-20(16(14)18)12-9-4-5-10-13(12)22-2/h4-5,9-11H,3,6-8,18H2,1-2H3 |
| InChIKey | RFQRPXCNNXSMBD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |