C19H19F3O — CID 14993513
2,2-difluoro-1-(4-fluorophenyl)-2-(4-pentylphenyl)ethanone (PubChem CID 14993513) has the molecular formula C19H19F3O and a molecular weight of 320.35 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-fluorophenyl)-2-(4-pentylphenyl)ethanone.
| Compound Name | 2,2-difluoro-1-(4-fluorophenyl)-2-(4-pentylphenyl)ethanone |
|---|---|
| PubChem CID | 14993513 |
| Molecular Formula | C19H19F3O |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2,2-difluoro-1-(4-fluorophenyl)-2-(4-pentylphenyl)ethanone |
| SMILES | CCCCCc1ccc(C(F)(F)C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19F3O/c1-2-3-4-5-14-6-10-16(11-7-14)19(21,22)18(23)15-8-12-17(20)13-9-15/h6-13H,2-5H2,1H3 |
| InChIKey | IFKFTIZVGSLKIJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|