C27H40N2O2S — CID 14995405
2-[(3-propoxy-2-pyridinyl)sulfanyl]-N-(2,4,6-trimethylphenyl)decanamide (PubChem CID 14995405) has the molecular formula C27H40N2O2S and a molecular weight of 456.70 g/mol. Its IUPAC name is 2-[(3-propoxy-2-pyridinyl)sulfanyl]-N-(2,4,6-trimethylphenyl)decanamide.
| Compound Name | 2-[(3-propoxy-2-pyridinyl)sulfanyl]-N-(2,4,6-trimethylphenyl)decanamide |
|---|---|
| PubChem CID | 14995405 |
| Molecular Formula | C27H40N2O2S |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 2-[(3-propoxy-2-pyridinyl)sulfanyl]-N-(2,4,6-trimethylphenyl)decanamide |
| SMILES | CCCCCCCCC(Sc1ncccc1OCCC)C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H40N2O2S/c1-6-8-9-10-11-12-15-24(32-27-23(31-17-7-2)14-13-16-28-27)26(30)29-25-21(4)18-20(3)19-22(25)5/h13-14,16,18-19,24H,6-12,15,17H2,1-5H3,(H,29,30) |
| InChIKey | PPBYAJIJZCBSGM-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|