C22H39N3OS3 — CID 19027774
N-[4,6-bis(methylsulfanyl)pyrimidin-5-yl]-2-hexylsulfanyldecanamide (PubChem CID 19027774) has the molecular formula C22H39N3OS3 and a molecular weight of 457.78 g/mol. Its IUPAC name is N-[4,6-bis(methylsulfanyl)pyrimidin-5-yl]-2-hexylsulfanyldecanamide.
| Compound Name | N-[4,6-bis(methylsulfanyl)pyrimidin-5-yl]-2-hexylsulfanyldecanamide |
|---|---|
| PubChem CID | 19027774 |
| Molecular Formula | C22H39N3OS3 |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[4,6-bis(methylsulfanyl)pyrimidin-5-yl]-2-hexylsulfanyldecanamide |
| SMILES | CCCCCCCCC(SCCCCCC)C(=O)Nc1c(SC)ncnc1SC |
| InChI | InChI=1S/C22H39N3OS3/c1-5-7-9-11-12-13-15-18(29-16-14-10-8-6-2)20(26)25-19-21(27-3)23-17-24-22(19)28-4/h17-18H,5-16H2,1-4H3,(H,25,26) |
| InChIKey | TZPMWEQBGJPMSZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|