C23H37N3OS — CID 14995435
2-hexylsulfanyl-N-imidazo[1,2-a]pyridin-3-yldecanamide (PubChem CID 14995435) has the molecular formula C23H37N3OS and a molecular weight of 403.64 g/mol. Its IUPAC name is 2-hexylsulfanyl-N-imidazo[1,2-a]pyridin-3-yldecanamide.
| Compound Name | 2-hexylsulfanyl-N-imidazo[1,2-a]pyridin-3-yldecanamide |
|---|---|
| PubChem CID | 14995435 |
| Molecular Formula | C23H37N3OS |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 2-hexylsulfanyl-N-imidazo[1,2-a]pyridin-3-yldecanamide |
| SMILES | CCCCCCCCC(SCCCCCC)C(=O)Nc1cnc2ccccn12 |
| InChI | InChI=1S/C23H37N3OS/c1-3-5-7-9-10-11-15-20(28-18-14-8-6-4-2)23(27)25-22-19-24-21-16-12-13-17-26(21)22/h12-13,16-17,19-20H,3-11,14-15,18H2,1-2H3,(H,25,27) |
| InChIKey | OYXAMZYKSUJJDQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|