C15H14N4O3S — CID 76848931
N-[4-(imidazo[1,2-a]pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 76848931) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[4-(imidazo[1,2-a]pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(imidazo[1,2-a]pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 76848931 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[4-(imidazo[1,2-a]pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cnc3ccccn23)cc1 |
| InChI | InChI=1S/C15H14N4O3S/c1-11(20)17-12-5-7-13(8-6-12)23(21,22)18-15-10-16-14-4-2-3-9-19(14)15/h2-10,18H,1H3,(H,17,20) |
| InChIKey | MSKWWSZGKHFPCB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |