C13H16N4O3S — CID 22209149
N-[4-[(1,5-dimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide (PubChem CID 22209149) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[4-[(1,5-dimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(1,5-dimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22209149 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[4-[(1,5-dimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cnn(C)c2C)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-9-13(8-14-17(9)3)16-21(19,20)12-6-4-11(5-7-12)15-10(2)18/h4-8,16H,1-3H3,(H,15,18) |
| InChIKey | RACVVMHXUIVZGD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |