C23H41N3OS2 — CID 19027843
2-heptyl-N-[2-methyl-4,6-bis(methylsulfanyl)pyrimidin-5-yl]nonanamide (PubChem CID 19027843) has the molecular formula C23H41N3OS2 and a molecular weight of 439.74 g/mol. Its IUPAC name is 2-heptyl-N-[2-methyl-4,6-bis(methylsulfanyl)pyrimidin-5-yl]nonanamide.
| Compound Name | 2-heptyl-N-[2-methyl-4,6-bis(methylsulfanyl)pyrimidin-5-yl]nonanamide |
|---|---|
| PubChem CID | 19027843 |
| Molecular Formula | C23H41N3OS2 |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-heptyl-N-[2-methyl-4,6-bis(methylsulfanyl)pyrimidin-5-yl]nonanamide |
| SMILES | CCCCCCCC(CCCCCCC)C(=O)Nc1c(SC)nc(C)nc1SC |
| InChI | InChI=1S/C23H41N3OS2/c1-6-8-10-12-14-16-19(17-15-13-11-9-7-2)21(27)26-20-22(28-4)24-18(3)25-23(20)29-5/h19H,6-17H2,1-5H3,(H,26,27) |
| InChIKey | GAGUACBFEQSIPT-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|