C20H28N2OS3 — CID 67745725
N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-2-thiophen-2-yloctanamide (PubChem CID 67745725) has the molecular formula C20H28N2OS3 and a molecular weight of 408.66 g/mol. Its IUPAC name is N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-2-thiophen-2-yloctanamide.
| Compound Name | N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-2-thiophen-2-yloctanamide |
|---|---|
| PubChem CID | 67745725 |
| Molecular Formula | C20H28N2OS3 |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-2-thiophen-2-yloctanamide |
| SMILES | CCCCCCC(C(=O)Nc1c(SC)cc(C)nc1SC)c1cccs1 |
| InChI | InChI=1S/C20H28N2OS3/c1-5-6-7-8-10-15(16-11-9-12-26-16)19(23)22-18-17(24-3)13-14(2)21-20(18)25-4/h9,11-13,15H,5-8,10H2,1-4H3,(H,22,23) |
| InChIKey | WTUJROXQFMKRDF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|