C17H28N2O2S — CID 67800421
(2R)-2-hydroxy-N-(6-methyl-4-methylsulfanyl-3-pyridinyl)decanamide (PubChem CID 67800421) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-(6-methyl-4-methylsulfanyl-3-pyridinyl)decanamide.
| Compound Name | (2R)-2-hydroxy-N-(6-methyl-4-methylsulfanyl-3-pyridinyl)decanamide |
|---|---|
| PubChem CID | 67800421 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R)-2-hydroxy-N-(6-methyl-4-methylsulfanyl-3-pyridinyl)decanamide |
| SMILES | CCCCCCCC[C@@H](O)C(=O)Nc1cnc(C)cc1SC |
| InChI | InChI=1S/C17H28N2O2S/c1-4-5-6-7-8-9-10-15(20)17(21)19-14-12-18-13(2)11-16(14)22-3/h11-12,15,20H,4-10H2,1-3H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | XQSCLADNBKNUEL-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|