C19H27N3O6 — CID 150000554
ethyl 2-[2-[(2R)-2-[(2-butan-2-yloxy-2-oxoethyl)amino]-3-phenylpropanoyl]hydrazinyl]-2-oxoacetate (PubChem CID 150000554) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 2-[2-[(2R)-2-[(2-butan-2-yloxy-2-oxoethyl)amino]-3-phenylpropanoyl]hydrazinyl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[(2R)-2-[(2-butan-2-yloxy-2-oxoethyl)amino]-3-phenylpropanoyl]hydrazinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 150000554 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | ethyl 2-[2-[(2R)-2-[(2-butan-2-yloxy-2-oxoethyl)amino]-3-phenylpropanoyl]hydrazinyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NNC(=O)[C@@H](Cc1ccccc1)NCC(=O)OC(C)CC |
| InChI | InChI=1S/C19H27N3O6/c1-4-13(3)28-16(23)12-20-15(11-14-9-7-6-8-10-14)17(24)21-22-18(25)19(26)27-5-2/h6-10,13,15,20H,4-5,11-12H2,1-3H3,(H,21,24)(H,22,25)/t13?,15-/m1/s1 |
| InChIKey | DBEQANMBHSGHQQ-AWKYBWMHSA-N |
| XLogP | 0.24 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|