C19H19ClF3N3O3 — CID 150005179
N-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 150005179) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is N-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 150005179 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[(3R)-6-chloro-3,4-dihydro-2H-chromen-3-yl]-6-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1COc2ccc(Cl)cc2C1)c1cn2c(n1)CCC(OCC(F)(F)F)C2 |
| InChI | InChI=1S/C19H19ClF3N3O3/c20-12-1-3-16-11(5-12)6-13(9-28-16)24-18(27)15-8-26-7-14(2-4-17(26)25-15)29-10-19(21,22)23/h1,3,5,8,13-14H,2,4,6-7,9-10H2,(H,24,27)/t13-,14?/m1/s1 |
| InChIKey | DCCWSUPKMKAGRX-KWCCSABGSA-N |
| XLogP | 3.16 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |