C16H23NO6S — CID 15001151
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-N-hydroxy-2,4,6-trimethylbenzenecarboximidothioate (PubChem CID 15001151) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-N-hydroxy-2,4,6-trimethylbenzenecarboximidothioate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-N-hydroxy-2,4,6-trimethylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 15001151 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-N-hydroxy-2,4,6-trimethylbenzenecarboximidothioate |
| SMILES | Cc1cc(C)c(/C(=N\O)S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(C)c1 |
| InChI | InChI=1S/C16H23NO6S/c1-7-4-8(2)11(9(3)5-7)15(17-22)24-16-14(21)13(20)12(19)10(6-18)23-16/h4-5,10,12-14,16,18-22H,6H2,1-3H3/b17-15+/t10-,12-,13+,14-,16+/m1/s1 |
| InChIKey | IEWYWNYHAZFVNH-UDDCBDBSSA-N |
| XLogP | 0.28 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|