C29H58O4 — CID 150019629
1-but-1-enoxy-4-[tris[(2-methylpropan-2-yl)oxy]methyl]dodecane (PubChem CID 150019629) has the molecular formula C29H58O4 and a molecular weight of 470.78 g/mol. Its IUPAC name is 1-but-1-enoxy-4-[tris[(2-methylpropan-2-yl)oxy]methyl]dodecane.
| Compound Name | 1-but-1-enoxy-4-[tris[(2-methylpropan-2-yl)oxy]methyl]dodecane |
|---|---|
| PubChem CID | 150019629 |
| Molecular Formula | C29H58O4 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.43 |
| IUPAC Name | 1-but-1-enoxy-4-[tris[(2-methylpropan-2-yl)oxy]methyl]dodecane |
| SMILES | CCC=COCCCC(CCCCCCCC)C(OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C29H58O4/c1-12-14-16-17-18-19-21-25(22-20-24-30-23-15-13-2)29(31-26(3,4)5,32-27(6,7)8)33-28(9,10)11/h15,23,25H,12-14,16-22,24H2,1-11H3 |
| InChIKey | DEZOYFJJWMLARN-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|