C42H84O8 — CID 162010772
1-but-1-enoxy-4-(triethoxymethyl)dodecane;1-prop-1-enoxy-4-(trimethoxymethyl)dodecane (PubChem CID 162010772) has the molecular formula C42H84O8 and a molecular weight of 717.13 g/mol. Its IUPAC name is 1-but-1-enoxy-4-(triethoxymethyl)dodecane;1-prop-1-enoxy-4-(trimethoxymethyl)dodecane.
| Compound Name | 1-but-1-enoxy-4-(triethoxymethyl)dodecane;1-prop-1-enoxy-4-(trimethoxymethyl)dodecane |
|---|---|
| PubChem CID | 162010772 |
| Molecular Formula | C42H84O8 |
| Molecular Weight | 717.13 g/mol |
| Exact Mass | 716.62 |
| IUPAC Name | 1-but-1-enoxy-4-(triethoxymethyl)dodecane;1-prop-1-enoxy-4-(trimethoxymethyl)dodecane |
| SMILES | CC=COCCCC(CCCCCCCC)C(OC)(OC)OC.CCC=COCCCC(CCCCCCCC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C23H46O4.C19H38O4/c1-6-11-13-14-15-16-18-22(19-17-21-24-20-12-7-2)23(25-8-3,26-9-4)27-10-5;1-6-8-9-10-11-12-14-18(15-13-17-23-16-7-2)19(20-3,21-4)22-5/h12,20,22H,6-11,13-19,21H2,1-5H3;7,16,18H,6,8-15,17H2,1-5H3 |
| InChIKey | YTLDBJJGKUXYNX-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.13 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|