C20H42O3 — CID 158397642
2,2-dimethoxyundecane;1-propoxybut-1-ene (PubChem CID 158397642) has the molecular formula C20H42O3 and a molecular weight of 330.55 g/mol. Its IUPAC name is 2,2-dimethoxyundecane;1-propoxybut-1-ene.
| Compound Name | 2,2-dimethoxyundecane;1-propoxybut-1-ene |
|---|---|
| PubChem CID | 158397642 |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 2,2-dimethoxyundecane;1-propoxybut-1-ene |
| SMILES | CCC=COCCC.CCCCCCCCCC(C)(OC)OC |
| InChI | InChI=1S/C13H28O2.C7H14O/c1-5-6-7-8-9-10-11-12-13(2,14-3)15-4;1-3-5-7-8-6-4-2/h5-12H2,1-4H3;5,7H,3-4,6H2,1-2H3 |
| InChIKey | GXSAUTHQODUXDI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|