C19H38O3 — CID 151268806
1-but-1-enoxy-2,2-diethoxyundecane (PubChem CID 151268806) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-but-1-enoxy-2,2-diethoxyundecane.
| Compound Name | 1-but-1-enoxy-2,2-diethoxyundecane |
|---|---|
| PubChem CID | 151268806 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 1-but-1-enoxy-2,2-diethoxyundecane |
| SMILES | CCC=COCC(CCCCCCCCC)(OCC)OCC |
| InChI | InChI=1S/C19H38O3/c1-5-9-11-12-13-14-15-16-19(21-7-3,22-8-4)18-20-17-10-6-2/h10,17H,5-9,11-16,18H2,1-4H3 |
| InChIKey | NVXKAFKNVWSCLH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|