C23H46O3 — CID 151121603
4-but-1-enoxy-3,3-diethoxy-4-propyldodecane (PubChem CID 151121603) has the molecular formula C23H46O3 and a molecular weight of 370.62 g/mol. Its IUPAC name is 4-but-1-enoxy-3,3-diethoxy-4-propyldodecane.
| Compound Name | 4-but-1-enoxy-3,3-diethoxy-4-propyldodecane |
|---|---|
| PubChem CID | 151121603 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | 4-but-1-enoxy-3,3-diethoxy-4-propyldodecane |
| SMILES | CCC=COC(CCC)(CCCCCCCC)C(CC)(OCC)OCC |
| InChI | InChI=1S/C23H46O3/c1-7-13-15-16-17-18-20-22(19-9-3,26-21-14-8-2)23(10-4,24-11-5)25-12-6/h14,21H,7-13,15-20H2,1-6H3 |
| InChIKey | MSHPNZLQRACVOA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|