C16H18ClN3O4 — CID 150038070
ethyl 2-[(2-chloro-6-methylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate (PubChem CID 150038070) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-6-methylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate.
| Compound Name | ethyl 2-[(2-chloro-6-methylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
|---|---|
| PubChem CID | 150038070 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | ethyl 2-[(2-chloro-6-methylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
| SMILES | CCOC(=O)C(Cn1cccn1)OC(=O)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C16H18ClN3O4/c1-3-23-15(21)13(10-20-9-5-8-18-20)24-16(22)19-14-11(2)6-4-7-12(14)17/h4-9,13H,3,10H2,1-2H3,(H,19,22) |
| InChIKey | DIROTGDKNBZUNQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |