C17H21N3O4 — CID 137462840
ethyl 2-[(2,6-dimethylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate (PubChem CID 137462840) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-[(2,6-dimethylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate.
| Compound Name | ethyl 2-[(2,6-dimethylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
|---|---|
| PubChem CID | 137462840 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | ethyl 2-[(2,6-dimethylphenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
| SMILES | CCOC(=O)C(Cn1cccn1)OC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H21N3O4/c1-4-23-16(21)14(11-20-10-6-9-18-20)24-17(22)19-15-12(2)7-5-8-13(15)3/h5-10,14H,4,11H2,1-3H3,(H,19,22) |
| InChIKey | UYNXZEOXFLSYPF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |