C15H14ClF2N3O4 — CID 150320487
ethyl 2-[(3-chloro-2,6-difluorophenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate (PubChem CID 150320487) has the molecular formula C15H14ClF2N3O4 and a molecular weight of 373.74 g/mol. Its IUPAC name is ethyl 2-[(3-chloro-2,6-difluorophenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate.
| Compound Name | ethyl 2-[(3-chloro-2,6-difluorophenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
|---|---|
| PubChem CID | 150320487 |
| Molecular Formula | C15H14ClF2N3O4 |
| Molecular Weight | 373.74 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 2-[(3-chloro-2,6-difluorophenyl)carbamoyloxy]-3-pyrazol-1-ylpropanoate |
| SMILES | CCOC(=O)C(Cn1cccn1)OC(=O)Nc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C15H14ClF2N3O4/c1-2-24-14(22)11(8-21-7-3-6-19-21)25-15(23)20-13-10(17)5-4-9(16)12(13)18/h3-7,11H,2,8H2,1H3,(H,20,23) |
| InChIKey | GNNJLFDZEGDDAI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|