C9H18FN3O — CID 150053263
N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]-N-hydroxyethanimidamide (PubChem CID 150053263) has the molecular formula C9H18FN3O and a molecular weight of 203.26 g/mol. Its IUPAC name is N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]-N-hydroxyethanimidamide.
| Compound Name | N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]-N-hydroxyethanimidamide |
|---|---|
| PubChem CID | 150053263 |
| Molecular Formula | C9H18FN3O |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N'-[(E,6S)-6-amino-2-fluorohept-2-enyl]-N-hydroxyethanimidamide |
| SMILES | C/C(=N\C/C(F)=C\CC[C@H](C)N)NO |
| InChI | InChI=1S/C9H18FN3O/c1-7(11)4-3-5-9(10)6-12-8(2)13-14/h5,7,14H,3-4,6,11H2,1-2H3,(H,12,13)/b9-5+/t7-/m0/s1 |
| InChIKey | DLTHTNDSZVCCHI-JGESFRBXSA-N |
| XLogP | 1.36 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|