C9H18FN3 — CID 141078393
N'-[(E,6R)-6-amino-2-fluorohept-2-enyl]ethanimidamide (PubChem CID 141078393) has the molecular formula C9H18FN3 and a molecular weight of 187.26 g/mol. Its IUPAC name is N'-[(E,6R)-6-amino-2-fluorohept-2-enyl]ethanimidamide.
| Compound Name | N'-[(E,6R)-6-amino-2-fluorohept-2-enyl]ethanimidamide |
|---|---|
| PubChem CID | 141078393 |
| Molecular Formula | C9H18FN3 |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | N'-[(E,6R)-6-amino-2-fluorohept-2-enyl]ethanimidamide |
| SMILES | C/C(N)=N\C/C(F)=C\CC[C@@H](C)N |
| InChI | InChI=1S/C9H18FN3/c1-7(11)4-3-5-9(10)6-13-8(2)12/h5,7H,3-4,6,11H2,1-2H3,(H2,12,13)/b9-5+/t7-/m1/s1 |
| InChIKey | LKXRKEXXUBOXSF-AJQDLKILSA-N |
| XLogP | 1.34 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|