C10H20FN3 — CID 87954621
N'-[(Z)-6-amino-2-fluoro-6-methylhept-2-enyl]ethanimidamide (PubChem CID 87954621) has the molecular formula C10H20FN3 and a molecular weight of 201.29 g/mol. Its IUPAC name is N'-[(Z)-6-amino-2-fluoro-6-methylhept-2-enyl]ethanimidamide.
| Compound Name | N'-[(Z)-6-amino-2-fluoro-6-methylhept-2-enyl]ethanimidamide |
|---|---|
| PubChem CID | 87954621 |
| Molecular Formula | C10H20FN3 |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N'-[(Z)-6-amino-2-fluoro-6-methylhept-2-enyl]ethanimidamide |
| SMILES | C/C(N)=N\C/C(F)=C/CCC(C)(C)N |
| InChI | InChI=1S/C10H20FN3/c1-8(12)14-7-9(11)5-4-6-10(2,3)13/h5H,4,6-7,13H2,1-3H3,(H2,12,14)/b9-5- |
| InChIKey | GSEWDRRLKNQDNE-UITAMQMPSA-N |
| XLogP | 1.73 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|