C10H19F2N3 — CID 87954903
N'-[(Z)-6-amino-2,3-difluoro-6-methylhept-2-enyl]ethanimidamide (PubChem CID 87954903) has the molecular formula C10H19F2N3 and a molecular weight of 219.28 g/mol. Its IUPAC name is N'-[(Z)-6-amino-2,3-difluoro-6-methylhept-2-enyl]ethanimidamide.
| Compound Name | N'-[(Z)-6-amino-2,3-difluoro-6-methylhept-2-enyl]ethanimidamide |
|---|---|
| PubChem CID | 87954903 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N'-[(Z)-6-amino-2,3-difluoro-6-methylhept-2-enyl]ethanimidamide |
| SMILES | C/C(N)=N\C/C(F)=C(/F)CCC(C)(C)N |
| InChI | InChI=1S/C10H19F2N3/c1-7(13)15-6-9(12)8(11)4-5-10(2,3)14/h4-6,14H2,1-3H3,(H2,13,15)/b9-8- |
| InChIKey | POPOYUHJLHRTLF-HJWRWDBZSA-N |
| XLogP | 2.03 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|