C10H21ClFN3 — CID 91238353
N'-[(E)-6-amino-3-fluoro-6-methylhept-2-enyl]ethanimidamide;hydrochloride (PubChem CID 91238353) has the molecular formula C10H21ClFN3 and a molecular weight of 237.75 g/mol. Its IUPAC name is N'-[(E)-6-amino-3-fluoro-6-methylhept-2-enyl]ethanimidamide;hydrochloride.
| Compound Name | N'-[(E)-6-amino-3-fluoro-6-methylhept-2-enyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 91238353 |
| Molecular Formula | C10H21ClFN3 |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N'-[(E)-6-amino-3-fluoro-6-methylhept-2-enyl]ethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\C/C=C(/F)CCC(C)(C)N.Cl |
| InChI | InChI=1S/C10H20FN3.ClH/c1-8(12)14-7-5-9(11)4-6-10(2,3)13;/h5H,4,6-7,13H2,1-3H3,(H2,12,14);1H/b9-5+; |
| InChIKey | BPARFMZTRNQAAL-SZKNIZGXSA-N |
| XLogP | 2.16 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|