C19H16BrNO4 — CID 150058150
methyl (2S)-3-(4-bromophenyl)-2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoate (PubChem CID 150058150) has the molecular formula C19H16BrNO4 and a molecular weight of 402.24 g/mol. Its IUPAC name is methyl (2S)-3-(4-bromophenyl)-2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoate.
| Compound Name | methyl (2S)-3-(4-bromophenyl)-2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 150058150 |
| Molecular Formula | C19H16BrNO4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | methyl (2S)-3-(4-bromophenyl)-2-(1,3-dioxoisoindol-2-yl)-2-methylpropanoate |
| SMILES | COC(=O)[C@](C)(Cc1ccc(Br)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16BrNO4/c1-19(18(24)25-2,11-12-7-9-13(20)10-8-12)21-16(22)14-5-3-4-6-15(14)17(21)23/h3-10H,11H2,1-2H3/t19-/m0/s1 |
| InChIKey | DMSVHFDHMZFSQF-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|