C23H47NO2 — CID 150064364
N-[3-(1,1-diethoxyethyl)undecyl]cyclohexanamine (PubChem CID 150064364) has the molecular formula C23H47NO2 and a molecular weight of 369.63 g/mol. Its IUPAC name is N-[3-(1,1-diethoxyethyl)undecyl]cyclohexanamine.
| Compound Name | N-[3-(1,1-diethoxyethyl)undecyl]cyclohexanamine |
|---|---|
| PubChem CID | 150064364 |
| Molecular Formula | C23H47NO2 |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.36 |
| IUPAC Name | N-[3-(1,1-diethoxyethyl)undecyl]cyclohexanamine |
| SMILES | CCCCCCCCC(CCNC1CCCCC1)C(C)(OCC)OCC |
| InChI | InChI=1S/C23H47NO2/c1-5-8-9-10-11-13-16-21(23(4,25-6-2)26-7-3)19-20-24-22-17-14-12-15-18-22/h21-22,24H,5-20H2,1-4H3 |
| InChIKey | DNYMSLGWQNMVDU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|