C11H17NOS — CID 15006487
4-propyl-2-thiophen-3-ylmorpholine (PubChem CID 15006487) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 4-propyl-2-thiophen-3-ylmorpholine.
| Compound Name | 4-propyl-2-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 15006487 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-propyl-2-thiophen-3-ylmorpholine |
| SMILES | CCCN1CCOC(c2ccsc2)C1 |
| InChI | InChI=1S/C11H17NOS/c1-2-4-12-5-6-13-11(8-12)10-3-7-14-9-10/h3,7,9,11H,2,4-6,8H2,1H3 |
| InChIKey | XJPUAINIELUZEP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |