C22H12F30O4 — CID 15006640
dimethyl 2,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)butanedioate (PubChem CID 15006640) has the molecular formula C22H12F30O4 and a molecular weight of 910.27 g/mol. Its IUPAC name is dimethyl 2,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)butanedioate.
| Compound Name | dimethyl 2,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)butanedioate |
|---|---|
| PubChem CID | 15006640 |
| Molecular Formula | C22H12F30O4 |
| Molecular Weight | 910.27 g/mol |
| Exact Mass | 910.03 |
| IUPAC Name | dimethyl 2,3-bis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)butanedioate |
| SMILES | COC(=O)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C22H12F30O4/c1-55-7(53)5(3-9(23,24)11(27,28)13(31,32)15(35,36)17(39,40)19(43,44)21(47,48)49)6(8(54)56-2)4-10(25,26)12(29,30)14(33,34)16(37,38)18(41,42)20(45,46)22(50,51)52/h5-6H,3-4H2,1-2H3 |
| InChIKey | SYWXBBUSEBCPOV-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.27 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|