C6H8N4 — CID 150070545
8,9-dihydro-5H-tetrazolo[1,5-a]azepine (PubChem CID 150070545) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is 8,9-dihydro-5H-tetrazolo[1,5-a]azepine.
| Compound Name | 8,9-dihydro-5H-tetrazolo[1,5-a]azepine |
|---|---|
| PubChem CID | 150070545 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 8,9-dihydro-5H-tetrazolo[1,5-a]azepine |
| SMILES | C1=CCn2nnnc2CC1 |
| InChI | InChI=1S/C6H8N4/c1-2-4-6-7-8-9-10(6)5-3-1/h1,3H,2,4-5H2 |
| InChIKey | DPEIHGKXZPNDRY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|