About 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine
3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine (PubChem CID 15010080) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine.
Analyze 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine (CID 15010080) is 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine is C1=NC2CCCNC2C1.
What is the InChIKey of 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine?
The InChIKey is ZIFOWVNHWMJLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-2-6-7(8-4-1)3-5-9-6/h5-8H,1-4H2.
What are the key properties of 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine?
3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine has a molecular weight of 124.19 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,5,6,7,7a-hexahydro-3H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 15010080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).