C10H12N4O3 — CID 150110347
cyclopropylcarbamoyl N-(3-amino-4-pyridinyl)carbamate (PubChem CID 150110347) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is cyclopropylcarbamoyl N-(3-amino-4-pyridinyl)carbamate.
| Compound Name | cyclopropylcarbamoyl N-(3-amino-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 150110347 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | cyclopropylcarbamoyl N-(3-amino-4-pyridinyl)carbamate |
| SMILES | Nc1cnccc1NC(=O)OC(=O)NC1CC1 |
| InChI | InChI=1S/C10H12N4O3/c11-7-5-12-4-3-8(7)14-10(16)17-9(15)13-6-1-2-6/h3-6H,1-2,11H2,(H,13,15)(H,12,14,16) |
| InChIKey | DXCLCZPSQROVTG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|