C17H20ClFN4O2 — CID 150114562
tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methylamino]carbamate (PubChem CID 150114562) has the molecular formula C17H20ClFN4O2 and a molecular weight of 366.82 g/mol. Its IUPAC name is tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methylamino]carbamate.
| Compound Name | tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methylamino]carbamate |
|---|---|
| PubChem CID | 150114562 |
| Molecular Formula | C17H20ClFN4O2 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | tert-butyl N-[[4-(2-chloro-5-fluoropyrimidin-4-yl)-2-methylphenyl]methylamino]carbamate |
| SMILES | Cc1cc(-c2nc(Cl)ncc2F)ccc1CNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20ClFN4O2/c1-10-7-11(14-13(19)9-20-15(18)22-14)5-6-12(10)8-21-23-16(24)25-17(2,3)4/h5-7,9,21H,8H2,1-4H3,(H,23,24) |
| InChIKey | DXYUNMLJWCDUPI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|