C20H22F3N5O2 — CID 18516966
tert-butyl N-[2-[4-[5-cyano-2-(trifluoromethylamino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate (PubChem CID 18516966) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[5-cyano-2-(trifluoromethylamino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[5-cyano-2-(trifluoromethylamino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 18516966 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | tert-butyl N-[2-[4-[5-cyano-2-(trifluoromethylamino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2nc(NC(F)(F)F)ncc2C#N)cc1 |
| InChI | InChI=1S/C20H22F3N5O2/c1-18(2,3)30-17(29)28-19(4,5)14-8-6-12(7-9-14)15-13(10-24)11-25-16(26-15)27-20(21,22)23/h6-9,11H,1-5H3,(H,28,29)(H,25,26,27) |
| InChIKey | PXIYZEKDMKEMEU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|