C15H12ClN3O6 — CID 150145724
5-chloro-N-[4-(2-hydroxyethyl)phenyl]-2,4-dinitrobenzamide (PubChem CID 150145724) has the molecular formula C15H12ClN3O6 and a molecular weight of 365.73 g/mol. Its IUPAC name is 5-chloro-N-[4-(2-hydroxyethyl)phenyl]-2,4-dinitrobenzamide.
| Compound Name | 5-chloro-N-[4-(2-hydroxyethyl)phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 150145724 |
| Molecular Formula | C15H12ClN3O6 |
| Molecular Weight | 365.73 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-chloro-N-[4-(2-hydroxyethyl)phenyl]-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12ClN3O6/c16-12-7-11(13(18(22)23)8-14(12)19(24)25)15(21)17-10-3-1-9(2-4-10)5-6-20/h1-4,7-8,20H,5-6H2,(H,17,21) |
| InChIKey | FEFFMOQGRBRFRO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|