C7H11N3O3S — CID 150152164
4-N-methyl-5-oxothiomorpholine-3,4-dicarboxamide (PubChem CID 150152164) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 4-N-methyl-5-oxothiomorpholine-3,4-dicarboxamide.
| Compound Name | 4-N-methyl-5-oxothiomorpholine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 150152164 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4-N-methyl-5-oxothiomorpholine-3,4-dicarboxamide |
| SMILES | CNC(=O)N1C(=O)CSCC1C(N)=O |
| InChI | InChI=1S/C7H11N3O3S/c1-9-7(13)10-4(6(8)12)2-14-3-5(10)11/h4H,2-3H2,1H3,(H2,8,12)(H,9,13) |
| InChIKey | FFLYRUNEJCFPCR-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |