C11H20O — CID 150162074
1-methoxy-2,6-dimethylocta-1,3-diene (PubChem CID 150162074) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-methoxy-2,6-dimethylocta-1,3-diene.
| Compound Name | 1-methoxy-2,6-dimethylocta-1,3-diene |
|---|---|
| PubChem CID | 150162074 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-methoxy-2,6-dimethylocta-1,3-diene |
| SMILES | CCC(C)CC=CC(C)=COC |
| InChI | InChI=1S/C11H20O/c1-5-10(2)7-6-8-11(3)9-12-4/h6,8-10H,5,7H2,1-4H3 |
| InChIKey | FHQPQGGJVDYORJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|