C20H24O4 — CID 150186373
[2-[3-[(2-methylpropan-2-yl)oxy]-1-phenylpropyl]phenyl] hydrogen carbonate (PubChem CID 150186373) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is [2-[3-[(2-methylpropan-2-yl)oxy]-1-phenylpropyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[3-[(2-methylpropan-2-yl)oxy]-1-phenylpropyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 150186373 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [2-[3-[(2-methylpropan-2-yl)oxy]-1-phenylpropyl]phenyl] hydrogen carbonate |
| SMILES | CC(C)(C)OCCC(c1ccccc1)c1ccccc1OC(=O)O |
| InChI | InChI=1S/C20H24O4/c1-20(2,3)23-14-13-16(15-9-5-4-6-10-15)17-11-7-8-12-18(17)24-19(21)22/h4-12,16H,13-14H2,1-3H3,(H,21,22) |
| InChIKey | FMNAWZJPCUTINE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|