C14H15Cl2NO3 — CID 150186966
3-(3-butyl-4,5-dihydro-1,2-oxazol-5-yl)-2,4-dichlorobenzoic acid (PubChem CID 150186966) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 3-(3-butyl-4,5-dihydro-1,2-oxazol-5-yl)-2,4-dichlorobenzoic acid.
| Compound Name | 3-(3-butyl-4,5-dihydro-1,2-oxazol-5-yl)-2,4-dichlorobenzoic acid |
|---|---|
| PubChem CID | 150186966 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-(3-butyl-4,5-dihydro-1,2-oxazol-5-yl)-2,4-dichlorobenzoic acid |
| SMILES | CCCCC1=NOC(c2c(Cl)ccc(C(=O)O)c2Cl)C1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-2-3-4-8-7-11(20-17-8)12-10(15)6-5-9(13(12)16)14(18)19/h5-6,11H,2-4,7H2,1H3,(H,18,19) |
| InChIKey | FMQBKGSWQJZXGA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |