C17H19F2N3O3 — CID 150188718
[[3-(difluoromethyl)-1-(oxan-2-yl)pyrazol-4-yl]-phenylmethyl] carbamate (PubChem CID 150188718) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is [[3-(difluoromethyl)-1-(oxan-2-yl)pyrazol-4-yl]-phenylmethyl] carbamate.
| Compound Name | [[3-(difluoromethyl)-1-(oxan-2-yl)pyrazol-4-yl]-phenylmethyl] carbamate |
|---|---|
| PubChem CID | 150188718 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [[3-(difluoromethyl)-1-(oxan-2-yl)pyrazol-4-yl]-phenylmethyl] carbamate |
| SMILES | NC(=O)OC(c1ccccc1)c1cn(C2CCCCO2)nc1C(F)F |
| InChI | InChI=1S/C17H19F2N3O3/c18-16(19)14-12(10-22(21-14)13-8-4-5-9-24-13)15(25-17(20)23)11-6-2-1-3-7-11/h1-3,6-7,10,13,15-16H,4-5,8-9H2,(H2,20,23) |
| InChIKey | FMZHABFSNLFDSI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |