C31H32N4O3 — CID 175203924
[1-[1-(benzhydrylideneamino)-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]cyclopropyl] carbamate (PubChem CID 175203924) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is [1-[1-(benzhydrylideneamino)-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]cyclopropyl] carbamate.
| Compound Name | [1-[1-(benzhydrylideneamino)-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]cyclopropyl] carbamate |
|---|---|
| PubChem CID | 175203924 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [1-[1-(benzhydrylideneamino)-2-[1-(oxan-2-yl)indazol-5-yl]ethyl]cyclopropyl] carbamate |
| SMILES | NC(=O)OC1(C(Cc2ccc3c(cnn3C3CCCCO3)c2)N=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H32N4O3/c32-30(36)38-31(16-17-31)27(34-29(23-9-3-1-4-10-23)24-11-5-2-6-12-24)20-22-14-15-26-25(19-22)21-33-35(26)28-13-7-8-18-37-28/h1-6,9-12,14-15,19,21,27-28H,7-8,13,16-18,20H2,(H2,32,36) |
| InChIKey | JWJQZBUOGPTPDH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|