C30H34N6O2 — CID 150193024
1-cyclopropyl-3-[(3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidin-3-yl]-1-[[1-(pyridin-4-ylmethyl)indol-3-yl]methyl]urea (PubChem CID 150193024) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidin-3-yl]-1-[[1-(pyridin-4-ylmethyl)indol-3-yl]methyl]urea.
| Compound Name | 1-cyclopropyl-3-[(3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidin-3-yl]-1-[[1-(pyridin-4-ylmethyl)indol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 150193024 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-cyclopropyl-3-[(3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidin-3-yl]-1-[[1-(pyridin-4-ylmethyl)indol-3-yl]methyl]urea |
| SMILES | Cn1ccc([C@@H]2CCNC[C@H]2NC(=O)N(Cc2cn(Cc3ccncc3)c3ccccc23)C2CC2)cc1=O |
| InChI | InChI=1S/C30H34N6O2/c1-34-15-11-22(16-29(34)37)25-10-14-32-17-27(25)33-30(38)36(24-6-7-24)20-23-19-35(18-21-8-12-31-13-9-21)28-5-3-2-4-26(23)28/h2-5,8-9,11-13,15-16,19,24-25,27,32H,6-7,10,14,17-18,20H2,1H3,(H,33,38)/t25-,27+/m0/s1 |
| InChIKey | FNVOFRRCVWYWAY-AHKZPQOWSA-N |
| XLogP | 3.60 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|