C20H30O4 — CID 150212551
2-(1-ethylcyclohexa-2,4-dien-1-yl)-5,5-bis(2-methylpropyl)-1,3-dioxane-4,6-dione (PubChem CID 150212551) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(1-ethylcyclohexa-2,4-dien-1-yl)-5,5-bis(2-methylpropyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(1-ethylcyclohexa-2,4-dien-1-yl)-5,5-bis(2-methylpropyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 150212551 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(1-ethylcyclohexa-2,4-dien-1-yl)-5,5-bis(2-methylpropyl)-1,3-dioxane-4,6-dione |
| SMILES | CCC1(C2OC(=O)C(CC(C)C)(CC(C)C)C(=O)O2)C=CC=CC1 |
| InChI | InChI=1S/C20H30O4/c1-6-19(10-8-7-9-11-19)18-23-16(21)20(12-14(2)3,13-15(4)5)17(22)24-18/h7-10,14-15,18H,6,11-13H2,1-5H3 |
| InChIKey | FRUIJQAZYOVHEU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|