C6H15ClN2O — CID 150213440
1-[2-(chloromethoxy)ethyl]-1,2,2-trimethylhydrazine (PubChem CID 150213440) has the molecular formula C6H15ClN2O and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-[2-(chloromethoxy)ethyl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[2-(chloromethoxy)ethyl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 150213440 |
| Molecular Formula | C6H15ClN2O |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-[2-(chloromethoxy)ethyl]-1,2,2-trimethylhydrazine |
| SMILES | CN(C)N(C)CCOCCl |
| InChI | InChI=1S/C6H15ClN2O/c1-8(2)9(3)4-5-10-6-7/h4-6H2,1-3H3 |
| InChIKey | FRYZCWYRFLNAAV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|