C16H20N4O4S — CID 150214070
tert-butyl N-[3-[(2-methylsulfonylpyrimidin-4-yl)amino]phenyl]carbamate (PubChem CID 150214070) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylsulfonylpyrimidin-4-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylsulfonylpyrimidin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 150214070 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tert-butyl N-[3-[(2-methylsulfonylpyrimidin-4-yl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2ccnc(S(C)(=O)=O)n2)c1 |
| InChI | InChI=1S/C16H20N4O4S/c1-16(2,3)24-15(21)19-12-7-5-6-11(10-12)18-13-8-9-17-14(20-13)25(4,22)23/h5-10H,1-4H3,(H,19,21)(H,17,18,20) |
| InChIKey | FSCGROFFNAKZOY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |