C13H9F3N2O3 — CID 150215382
4-[3-(2,2,2-trifluoroethoxy)pyrazin-2-yl]oxybenzaldehyde (PubChem CID 150215382) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethoxy)pyrazin-2-yl]oxybenzaldehyde.
| Compound Name | 4-[3-(2,2,2-trifluoroethoxy)pyrazin-2-yl]oxybenzaldehyde |
|---|---|
| PubChem CID | 150215382 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethoxy)pyrazin-2-yl]oxybenzaldehyde |
| SMILES | O=Cc1ccc(Oc2nccnc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9F3N2O3/c14-13(15,16)8-20-11-12(18-6-5-17-11)21-10-3-1-9(7-19)2-4-10/h1-7H,8H2 |
| InChIKey | FSJGDBRPPIPXNI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|